C23H22BrN5O9 — CID 160596456
2-(2-aminoethyl)-4-nitrophenol;2-(bromomethyl)-4-nitrophenol;2-(2-hydroxy-5-nitrophenyl)acetonitrile (PubChem CID 160596456) has the molecular formula C23H22BrN5O9 and a molecular weight of 592.36 g/mol. Its IUPAC name is 2-(2-aminoethyl)-4-nitrophenol;2-(bromomethyl)-4-nitrophenol;2-(2-hydroxy-5-nitrophenyl)acetonitrile.
| Compound Name | 2-(2-aminoethyl)-4-nitrophenol;2-(bromomethyl)-4-nitrophenol;2-(2-hydroxy-5-nitrophenyl)acetonitrile |
|---|---|
| PubChem CID | 160596456 |
| Molecular Formula | C23H22BrN5O9 |
| Molecular Weight | 592.36 g/mol |
| Exact Mass | 591.06 |
| IUPAC Name | 2-(2-aminoethyl)-4-nitrophenol;2-(bromomethyl)-4-nitrophenol;2-(2-hydroxy-5-nitrophenyl)acetonitrile |
| SMILES | N#CCc1cc([N+](=O)[O-])ccc1O.NCCc1cc([N+](=O)[O-])ccc1O.O=[N+]([O-])c1ccc(O)c(CBr)c1 |
| InChI | InChI=1S/C8H10N2O3.C8H6N2O3.C7H6BrNO3/c2*9-4-3-6-5-7(10(12)13)1-2-8(6)11;8-4-5-3-6(9(11)12)1-2-7(5)10/h1-2,5,11H,3-4,9H2;1-2,5,11H,3H2;1-3,10H,4H2 |
| InChIKey | RDRWPXBTLWPOMC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 239.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|