About buta-1,3-diene;2-methylbut-3-enenitrile
buta-1,3-diene;2-methylbut-3-enenitrile (PubChem CID 160597489) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is buta-1,3-diene;2-methylbut-3-enenitrile.
Molecular Properties
| Compound Name | buta-1,3-diene;2-methylbut-3-enenitrile |
| PubChem CID | 160597489 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | buta-1,3-diene;2-methylbut-3-enenitrile |
| SMILES | C=CC(C)C#N.C=CC=C |
| InChI | InChI=1S/C5H7N.C4H6/c1-3-5(2)4-6;1-3-4-2/h3,5H,1H2,2H3;3-4H,1-2H2 |
| InChIKey | RDVDUEGCMHJHQH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze buta-1,3-diene;2-methylbut-3-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-1,3-diene;2-methylbut-3-enenitrile?
The IUPAC name of buta-1,3-diene;2-methylbut-3-enenitrile (CID 160597489) is buta-1,3-diene;2-methylbut-3-enenitrile.
What is the SMILES notation for buta-1,3-diene;2-methylbut-3-enenitrile?
The canonical SMILES for buta-1,3-diene;2-methylbut-3-enenitrile is C=CC(C)C#N.C=CC=C.
What is the InChIKey of buta-1,3-diene;2-methylbut-3-enenitrile?
The InChIKey is RDVDUEGCMHJHQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N.C4H6/c1-3-5(2)4-6;1-3-4-2/h3,5H,1H2,2H3;3-4H,1-2H2.
What are the key properties of buta-1,3-diene;2-methylbut-3-enenitrile?
buta-1,3-diene;2-methylbut-3-enenitrile has a molecular weight of 135.21 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for buta-1,3-diene;2-methylbut-3-enenitrile is sourced from PubChem (CID 160597489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).