C9H13N — CID 160597489
buta-1,3-diene;2-methylbut-3-enenitrile (PubChem CID 160597489) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is buta-1,3-diene;2-methylbut-3-enenitrile.
| Compound Name | buta-1,3-diene;2-methylbut-3-enenitrile |
|---|---|
| PubChem CID | 160597489 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | buta-1,3-diene;2-methylbut-3-enenitrile |
| SMILES | C=CC(C)C#N.C=CC=C |
| InChI | InChI=1S/C5H7N.C4H6/c1-3-5(2)4-6;1-3-4-2/h3,5H,1H2,2H3;3-4H,1-2H2 |
| InChIKey | RDVDUEGCMHJHQH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|