About chloromethane;4-chloropyrimidine-5-carbonitrile;ethane
chloromethane;4-chloropyrimidine-5-carbonitrile;ethane (PubChem CID 160597687) has the molecular formula C8H11Cl2N3
and a molecular weight of 220.10 g/mol. Its IUPAC name is chloromethane;4-chloropyrimidine-5-carbonitrile;ethane.
Molecular Properties
| Compound Name | chloromethane;4-chloropyrimidine-5-carbonitrile;ethane |
| PubChem CID | 160597687 |
| Molecular Formula | C8H11Cl2N3 |
| Molecular Weight | 220.10 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | chloromethane;4-chloropyrimidine-5-carbonitrile;ethane |
| SMILES | CC.CCl.N#Cc1cncnc1Cl |
| InChI | InChI=1S/C5H2ClN3.C2H6.CH3Cl/c6-5-4(1-7)2-8-3-9-5;2*1-2/h2-3H;1-2H3;1H3 |
| InChIKey | RDVWGUKJSOUYIL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.10 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;4-chloropyrimidine-5-carbonitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;4-chloropyrimidine-5-carbonitrile;ethane?
The IUPAC name of chloromethane;4-chloropyrimidine-5-carbonitrile;ethane (CID 160597687) is chloromethane;4-chloropyrimidine-5-carbonitrile;ethane.
What is the SMILES notation for chloromethane;4-chloropyrimidine-5-carbonitrile;ethane?
The canonical SMILES for chloromethane;4-chloropyrimidine-5-carbonitrile;ethane is CC.CCl.N#Cc1cncnc1Cl.
What is the InChIKey of chloromethane;4-chloropyrimidine-5-carbonitrile;ethane?
The InChIKey is RDVWGUKJSOUYIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2ClN3.C2H6.CH3Cl/c6-5-4(1-7)2-8-3-9-5;2*1-2/h2-3H;1-2H3;1H3.
What are the key properties of chloromethane;4-chloropyrimidine-5-carbonitrile;ethane?
chloromethane;4-chloropyrimidine-5-carbonitrile;ethane has a molecular weight of 220.10 g/mol, XLogP of 2.88, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;4-chloropyrimidine-5-carbonitrile;ethane is sourced from PubChem (CID 160597687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).