About (hydroxy-oxido-phosphanylidene-λ5-phosphanyl)oxy-methylphosphinate
(hydroxy-oxido-phosphanylidene-λ5-phosphanyl)oxy-methylphosphinate (PubChem CID 160598126) has the molecular formula CH5O5P3-2
and a molecular weight of 189.97 g/mol. Its IUPAC name is (hydroxy-oxido-phosphanylidene-λ5-phosphanyl)oxy-methylphosphinate.
Molecular Properties
| Compound Name | (hydroxy-oxido-phosphanylidene-λ5-phosphanyl)oxy-methylphosphinate |
| PubChem CID | 160598126 |
| Molecular Formula | CH5O5P3-2 |
| Molecular Weight | 189.97 g/mol |
| Exact Mass | 189.94 |
| IUPAC Name | (hydroxy-oxido-phosphanylidene-λ5-phosphanyl)oxy-methylphosphinate |
| SMILES | [H]P=P([O-])(O)OP(C)(=O)[O-] |
| InChI | InChI=1S/CH6O5P3/c1-8(2,3)6-9(4,5)7/h7H,1H3,(H2-,2,3,4,5)/q-1/p-1 |
| InChIKey | RDXHZMKLOGDAHH-UHFFFAOYSA-M |
| XLogP | -0.64 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.97 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (hydroxy-oxido-phosphanylidene-λ5-phosphanyl)oxy-methylphosphinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (hydroxy-oxido-phosphanylidene-λ5-phosphanyl)oxy-methylphosphinate?
The IUPAC name of (hydroxy-oxido-phosphanylidene-λ5-phosphanyl)oxy-methylphosphinate (CID 160598126) is (hydroxy-oxido-phosphanylidene-λ5-phosphanyl)oxy-methylphosphinate.
What is the SMILES notation for (hydroxy-oxido-phosphanylidene-λ5-phosphanyl)oxy-methylphosphinate?
The canonical SMILES for (hydroxy-oxido-phosphanylidene-λ5-phosphanyl)oxy-methylphosphinate is [H]P=P([O-])(O)OP(C)(=O)[O-].
What is the InChIKey of (hydroxy-oxido-phosphanylidene-λ5-phosphanyl)oxy-methylphosphinate?
The InChIKey is RDXHZMKLOGDAHH-UHFFFAOYSA-M. The full InChI is InChI=1S/CH6O5P3/c1-8(2,3)6-9(4,5)7/h7H,1H3,(H2-,2,3,4,5)/q-1/p-1.
What are the key properties of (hydroxy-oxido-phosphanylidene-λ5-phosphanyl)oxy-methylphosphinate?
(hydroxy-oxido-phosphanylidene-λ5-phosphanyl)oxy-methylphosphinate has a molecular weight of 189.97 g/mol, XLogP of -0.64, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (hydroxy-oxido-phosphanylidene-λ5-phosphanyl)oxy-methylphosphinate is sourced from PubChem (CID 160598126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).