C42H37F3N2O4 — CID 160605077
[2-(benzylamino)-5-fluoro-4-methoxyphenyl]-phenylmethanone;(2,5-difluoro-4-methoxyphenyl)-phenylmethanone;phenylmethanamine (PubChem CID 160605077) has the molecular formula C42H37F3N2O4 and a molecular weight of 690.76 g/mol. Its IUPAC name is [2-(benzylamino)-5-fluoro-4-methoxyphenyl]-phenylmethanone;(2,5-difluoro-4-methoxyphenyl)-phenylmethanone;phenylmethanamine.
| Compound Name | [2-(benzylamino)-5-fluoro-4-methoxyphenyl]-phenylmethanone;(2,5-difluoro-4-methoxyphenyl)-phenylmethanone;phenylmethanamine |
|---|---|
| PubChem CID | 160605077 |
| Molecular Formula | C42H37F3N2O4 |
| Molecular Weight | 690.76 g/mol |
| Exact Mass | 690.27 |
| IUPAC Name | [2-(benzylamino)-5-fluoro-4-methoxyphenyl]-phenylmethanone;(2,5-difluoro-4-methoxyphenyl)-phenylmethanone;phenylmethanamine |
| SMILES | COc1cc(F)c(C(=O)c2ccccc2)cc1F.COc1cc(NCc2ccccc2)c(C(=O)c2ccccc2)cc1F.NCc1ccccc1 |
| InChI | InChI=1S/C21H18FNO2.C14H10F2O2.C7H9N/c1-25-20-13-19(23-14-15-8-4-2-5-9-15)17(12-18(20)22)21(24)16-10-6-3-7-11-16;1-18-13-8-11(15)10(7-12(13)16)14(17)9-5-3-2-4-6-9;8-6-7-4-2-1-3-5-7/h2-13,23H,14H2,1H3;2-8H,1H3;1-5H,6,8H2 |
| InChIKey | RETPBFCUSADDRL-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.76 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|