C35H33Br2NO2 — CID 160606015
2-bromo-9H-fluorene;2-bromo-9-(oxan-2-yl)carbazole;3,4-dihydro-2H-pyran (PubChem CID 160606015) has the molecular formula C35H33Br2NO2 and a molecular weight of 659.46 g/mol. Its IUPAC name is 2-bromo-9H-fluorene;2-bromo-9-(oxan-2-yl)carbazole;3,4-dihydro-2H-pyran.
| Compound Name | 2-bromo-9H-fluorene;2-bromo-9-(oxan-2-yl)carbazole;3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 160606015 |
| Molecular Formula | C35H33Br2NO2 |
| Molecular Weight | 659.46 g/mol |
| Exact Mass | 657.09 |
| IUPAC Name | 2-bromo-9H-fluorene;2-bromo-9-(oxan-2-yl)carbazole;3,4-dihydro-2H-pyran |
| SMILES | Brc1ccc2c(c1)Cc1ccccc1-2.Brc1ccc2c3ccccc3n(C3CCCCO3)c2c1.C1=COCCC1 |
| InChI | InChI=1S/C17H16BrNO.C13H9Br.C5H8O/c18-12-8-9-14-13-5-1-2-6-15(13)19(16(14)11-12)17-7-3-4-10-20-17;14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13;1-2-4-6-5-3-1/h1-2,5-6,8-9,11,17H,3-4,7,10H2;1-6,8H,7H2;2,4H,1,3,5H2 |
| InChIKey | REWLVINTLPHTTM-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.46 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |