About 3-methyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrol-6-amine
3-methyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrol-6-amine (PubChem CID 160607671) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 3-methyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrol-6-amine.
Analyze 3-methyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrol-6-amine?
The IUPAC name of 3-methyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrol-6-amine (CID 160607671) is 3-methyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrol-6-amine.
What is the SMILES notation for 3-methyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrol-6-amine?
The canonical SMILES for 3-methyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrol-6-amine is CC1=NCC2=C1CCC2N.
What is the InChIKey of 3-methyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrol-6-amine?
The InChIKey is KVXNWKRTCOWLLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-5-6-2-3-8(9)7(6)4-10-5/h8H,2-4,9H2,1H3.
What are the key properties of 3-methyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrol-6-amine?
3-methyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrol-6-amine has a molecular weight of 136.20 g/mol, XLogP of 0.88, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrol-6-amine is sourced from PubChem (CID 160607671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).