C12H22N2 — CID 90798400
3,4-diethyl-2-iminocyclooct-3-en-1-amine (PubChem CID 90798400) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 3,4-diethyl-2-iminocyclooct-3-en-1-amine.
| Compound Name | 3,4-diethyl-2-iminocyclooct-3-en-1-amine |
|---|---|
| PubChem CID | 90798400 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 3,4-diethyl-2-iminocyclooct-3-en-1-amine |
| SMILES | [H]/N=C1\C(CC)=C(CC)CCCCC1N |
| InChI | InChI=1S/C12H22N2/c1-3-9-7-5-6-8-11(13)12(14)10(9)4-2/h11,14H,3-8,13H2,1-2H3/b10-9?,14-12+ |
| InChIKey | RHSKNXVVTWKCGR-CNMAPRNFSA-N |
| XLogP | 3.02 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|