About 2-imino-3,4-dimethylcyclopent-3-en-1-amine
2-imino-3,4-dimethylcyclopent-3-en-1-amine (PubChem CID 91382058) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 2-imino-3,4-dimethylcyclopent-3-en-1-amine.
Molecular Properties
| Compound Name | 2-imino-3,4-dimethylcyclopent-3-en-1-amine |
| PubChem CID | 91382058 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 2-imino-3,4-dimethylcyclopent-3-en-1-amine |
| SMILES | [H]/N=C1\C(C)=C(C)CC1N |
| InChI | InChI=1S/C7H12N2/c1-4-3-6(8)7(9)5(4)2/h6,9H,3,8H2,1-2H3/b9-7+ |
| InChIKey | ZURWVTVFNNTSAB-VQHVLOKHSA-N |
| XLogP | 1.07 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-imino-3,4-dimethylcyclopent-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-3,4-dimethylcyclopent-3-en-1-amine?
The IUPAC name of 2-imino-3,4-dimethylcyclopent-3-en-1-amine (CID 91382058) is 2-imino-3,4-dimethylcyclopent-3-en-1-amine.
What is the SMILES notation for 2-imino-3,4-dimethylcyclopent-3-en-1-amine?
The canonical SMILES for 2-imino-3,4-dimethylcyclopent-3-en-1-amine is [H]/N=C1\C(C)=C(C)CC1N.
What is the InChIKey of 2-imino-3,4-dimethylcyclopent-3-en-1-amine?
The InChIKey is ZURWVTVFNNTSAB-VQHVLOKHSA-N. The full InChI is InChI=1S/C7H12N2/c1-4-3-6(8)7(9)5(4)2/h6,9H,3,8H2,1-2H3/b9-7+.
What are the key properties of 2-imino-3,4-dimethylcyclopent-3-en-1-amine?
2-imino-3,4-dimethylcyclopent-3-en-1-amine has a molecular weight of 124.19 g/mol, XLogP of 1.07, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-3,4-dimethylcyclopent-3-en-1-amine is sourced from PubChem (CID 91382058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).