C9H16N2 — CID 91549426
3,4-diethyl-2-iminocyclopent-3-en-1-amine (PubChem CID 91549426) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 3,4-diethyl-2-iminocyclopent-3-en-1-amine.
| Compound Name | 3,4-diethyl-2-iminocyclopent-3-en-1-amine |
|---|---|
| PubChem CID | 91549426 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 3,4-diethyl-2-iminocyclopent-3-en-1-amine |
| SMILES | [H]/N=C1\C(CC)=C(CC)CC1N |
| InChI | InChI=1S/C9H16N2/c1-3-6-5-8(10)9(11)7(6)4-2/h8,11H,3-5,10H2,1-2H3/b11-9+ |
| InChIKey | YBQNKUVOXTVUSP-PKNBQFBNSA-N |
| XLogP | 1.85 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|