C10H18N2 — CID 91108254
3,4-diethyl-2-iminocyclohex-3-en-1-amine (PubChem CID 91108254) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 3,4-diethyl-2-iminocyclohex-3-en-1-amine.
| Compound Name | 3,4-diethyl-2-iminocyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 91108254 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 3,4-diethyl-2-iminocyclohex-3-en-1-amine |
| SMILES | [H]/N=C1\C(CC)=C(CC)CCC1N |
| InChI | InChI=1S/C10H18N2/c1-3-7-5-6-9(11)10(12)8(7)4-2/h9,12H,3-6,11H2,1-2H3/b12-10+ |
| InChIKey | XLRXUHUTFZZZMS-ZRDIBKRKSA-N |
| XLogP | 2.24 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|