C8H14N2 — CID 91179392
2-imino-3,4-dimethylcyclohex-3-en-1-amine (PubChem CID 91179392) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 2-imino-3,4-dimethylcyclohex-3-en-1-amine.
| Compound Name | 2-imino-3,4-dimethylcyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 91179392 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 2-imino-3,4-dimethylcyclohex-3-en-1-amine |
| SMILES | [H]/N=C1\C(C)=C(C)CCC1N |
| InChI | InChI=1S/C8H14N2/c1-5-3-4-7(9)8(10)6(5)2/h7,10H,3-4,9H2,1-2H3/b10-8+ |
| InChIKey | DFCTUHLXITXGOD-CSKARUKUSA-N |
| XLogP | 1.46 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|