C34H39BrN6O4 — CID 160609741
3-cyclohexyl-6-isocyano-1H-pyrrolo[2,3-b]pyridine;methyl 2-bromoacetate;methyl 2-(3-cyclohexyl-6-isocyanopyrrolo[2,3-b]pyridin-1-yl)acetate (PubChem CID 160609741) has the molecular formula C34H39BrN6O4 and a molecular weight of 675.63 g/mol. Its IUPAC name is 3-cyclohexyl-6-isocyano-1H-pyrrolo[2,3-b]pyridine;methyl 2-bromoacetate;methyl 2-(3-cyclohexyl-6-isocyanopyrrolo[2,3-b]pyridin-1-yl)acetate.
| Compound Name | 3-cyclohexyl-6-isocyano-1H-pyrrolo[2,3-b]pyridine;methyl 2-bromoacetate;methyl 2-(3-cyclohexyl-6-isocyanopyrrolo[2,3-b]pyridin-1-yl)acetate |
|---|---|
| PubChem CID | 160609741 |
| Molecular Formula | C34H39BrN6O4 |
| Molecular Weight | 675.63 g/mol |
| Exact Mass | 674.22 |
| IUPAC Name | 3-cyclohexyl-6-isocyano-1H-pyrrolo[2,3-b]pyridine;methyl 2-bromoacetate;methyl 2-(3-cyclohexyl-6-isocyanopyrrolo[2,3-b]pyridin-1-yl)acetate |
| SMILES | COC(=O)CBr.[C-]#[N+]c1ccc2c(C3CCCCC3)c[nH]c2n1.[C-]#[N+]c1ccc2c(C3CCCCC3)cn(CC(=O)OC)c2n1 |
| InChI | InChI=1S/C17H19N3O2.C14H15N3.C3H5BrO2/c1-18-15-9-8-13-14(12-6-4-3-5-7-12)10-20(17(13)19-15)11-16(21)22-2;1-15-13-8-7-11-12(9-16-14(11)17-13)10-5-3-2-4-6-10;1-6-3(5)2-4/h8-10,12H,3-7,11H2,2H3;7-10H,2-6H2,(H,16,17);2H2,1H3 |
| InChIKey | RFIWRJAVQUBKFE-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.63 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|