About CID 160626565
CID 160626565 (PubChem CID 160626565) has the molecular formula C4H9BNO2S
and a molecular weight of 146.00 g/mol.
Molecular Properties
| Compound Name | CID 160626565 |
| PubChem CID | 160626565 |
| Molecular Formula | C4H9BNO2S |
| Molecular Weight | 146.00 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | — |
| SMILES | CNC([B]S)C(=O)OC |
| InChI | InChI=1S/C4H9BNO2S/c1-6-3(5-9)4(7)8-2/h3,6,9H,1-2H3 |
| InChIKey | QKKAZQPXGVIADD-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.00 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 160626565 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 160626565?
The IUPAC name of CID 160626565 (CID 160626565) is not available.
What is the SMILES notation for CID 160626565?
The canonical SMILES for CID 160626565 is CNC([B]S)C(=O)OC.
What is the InChIKey of CID 160626565?
The InChIKey is QKKAZQPXGVIADD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9BNO2S/c1-6-3(5-9)4(7)8-2/h3,6,9H,1-2H3.
What are the key properties of CID 160626565?
CID 160626565 has a molecular weight of 146.00 g/mol, XLogP of -0.75, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 160626565 is sourced from PubChem (CID 160626565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).