C6H12N2O3 — CID 86679247
methyl (2R)-2,3-bis(methylamino)-3-oxopropanoate (PubChem CID 86679247) has the molecular formula C6H12N2O3 and a molecular weight of 160.17 g/mol. Its IUPAC name is methyl (2R)-2,3-bis(methylamino)-3-oxopropanoate.
| Compound Name | methyl (2R)-2,3-bis(methylamino)-3-oxopropanoate |
|---|---|
| PubChem CID | 86679247 |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | methyl (2R)-2,3-bis(methylamino)-3-oxopropanoate |
| SMILES | CNC(=O)[C@@H](NC)C(=O)OC |
| InChI | InChI=1S/C6H12N2O3/c1-7-4(5(9)8-2)6(10)11-3/h4,7H,1-3H3,(H,8,9)/t4-/m1/s1 |
| InChIKey | ATPWTHOJTZFNEH-SCSAIBSYSA-N |
| XLogP | -1.51 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|