C36H54O12S — CID 160628006
[(2R)-2-[(3S,4S)-5-acetyloxy-3,4-dimethyl-6-phenylsulfanyloxan-2-yl]propyl] acetate;[(2R)-2-[(3S,4S)-5,6-diacetyloxy-3,4-dimethyloxan-2-yl]propyl] acetate (PubChem CID 160628006) has the molecular formula C36H54O12S and a molecular weight of 710.88 g/mol. Its IUPAC name is [(2R)-2-[(3S,4S)-5-acetyloxy-3,4-dimethyl-6-phenylsulfanyloxan-2-yl]propyl] acetate;[(2R)-2-[(3S,4S)-5,6-diacetyloxy-3,4-dimethyloxan-2-yl]propyl] acetate.
| Compound Name | [(2R)-2-[(3S,4S)-5-acetyloxy-3,4-dimethyl-6-phenylsulfanyloxan-2-yl]propyl] acetate;[(2R)-2-[(3S,4S)-5,6-diacetyloxy-3,4-dimethyloxan-2-yl]propyl] acetate |
|---|---|
| PubChem CID | 160628006 |
| Molecular Formula | C36H54O12S |
| Molecular Weight | 710.88 g/mol |
| Exact Mass | 710.33 |
| IUPAC Name | [(2R)-2-[(3S,4S)-5-acetyloxy-3,4-dimethyl-6-phenylsulfanyloxan-2-yl]propyl] acetate;[(2R)-2-[(3S,4S)-5,6-diacetyloxy-3,4-dimethyloxan-2-yl]propyl] acetate |
| SMILES | CC(=O)OC[C@@H](C)C1OC(OC(C)=O)C(OC(C)=O)[C@@H](C)[C@@H]1C.CC(=O)OC[C@@H](C)C1OC(Sc2ccccc2)C(OC(C)=O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C20H28O5S.C16H26O7/c1-12(11-23-15(4)21)18-13(2)14(3)19(24-16(5)22)20(25-18)26-17-9-7-6-8-10-17;1-8(7-20-11(4)17)14-9(2)10(3)15(21-12(5)18)16(23-14)22-13(6)19/h6-10,12-14,18-20H,11H2,1-5H3;8-10,14-16H,7H2,1-6H3/t12-,13+,14+,18?,19?,20?;8-,9+,10+,14?,15?,16?/m11/s1 |
| InChIKey | RHODFNXWSOLFJN-SFYRZENESA-N |
| XLogP | 5.58 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.88 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|