C27H24N4O2 — CID 160629868
3-[(E)-3-[2-(1H-imidazol-2-yl)anilino]-3-oxoprop-1-enyl]-N-methyl-N-(3-methylphenyl)benzamide (PubChem CID 160629868) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 3-[(E)-3-[2-(1H-imidazol-2-yl)anilino]-3-oxoprop-1-enyl]-N-methyl-N-(3-methylphenyl)benzamide.
| Compound Name | 3-[(E)-3-[2-(1H-imidazol-2-yl)anilino]-3-oxoprop-1-enyl]-N-methyl-N-(3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 160629868 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 3-[(E)-3-[2-(1H-imidazol-2-yl)anilino]-3-oxoprop-1-enyl]-N-methyl-N-(3-methylphenyl)benzamide |
| SMILES | Cc1cccc(N(C)C(=O)c2cccc(/C=C/C(=O)Nc3ccccc3-c3ncc[nH]3)c2)c1 |
| InChI | InChI=1S/C27H24N4O2/c1-19-7-5-10-22(17-19)31(2)27(33)21-9-6-8-20(18-21)13-14-25(32)30-24-12-4-3-11-23(24)26-28-15-16-29-26/h3-18H,1-2H3,(H,28,29)(H,30,32)/b14-13+ |
| InChIKey | RHTYZIHRNQIRDL-BUHFOSPRSA-N |
| XLogP | 5.31 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|