C18H16Cl2N6O5 — CID 160634737
6-chloropyridine-3-carbaldehyde;methyl 2-azidoacetate;methyl 6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate (PubChem CID 160634737) has the molecular formula C18H16Cl2N6O5 and a molecular weight of 467.27 g/mol. Its IUPAC name is 6-chloropyridine-3-carbaldehyde;methyl 2-azidoacetate;methyl 6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate.
| Compound Name | 6-chloropyridine-3-carbaldehyde;methyl 2-azidoacetate;methyl 6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 160634737 |
| Molecular Formula | C18H16Cl2N6O5 |
| Molecular Weight | 467.27 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | 6-chloropyridine-3-carbaldehyde;methyl 2-azidoacetate;methyl 6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate |
| SMILES | COC(=O)CN=[N+]=[N-].COC(=O)c1cc2ccc(Cl)nc2[nH]1.O=Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C9H7ClN2O2.C6H4ClNO.C3H5N3O2/c1-14-9(13)6-4-5-2-3-7(10)12-8(5)11-6;7-6-2-1-5(4-9)3-8-6;1-8-3(7)2-5-6-4/h2-4H,1H3,(H,11,12);1-4H;2H2,1H3 |
| InChIKey | RIJUKZAUQJJXIV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 160.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|