C26H47O2P — CID 160640464
3-[5-[bis(6-methylheptyl)phosphanyl]pentyl]penta-1,4-diene-1,5-dione (PubChem CID 160640464) has the molecular formula C26H47O2P and a molecular weight of 422.63 g/mol. Its IUPAC name is 3-[5-[bis(6-methylheptyl)phosphanyl]pentyl]penta-1,4-diene-1,5-dione.
| Compound Name | 3-[5-[bis(6-methylheptyl)phosphanyl]pentyl]penta-1,4-diene-1,5-dione |
|---|---|
| PubChem CID | 160640464 |
| Molecular Formula | C26H47O2P |
| Molecular Weight | 422.63 g/mol |
| Exact Mass | 422.33 |
| IUPAC Name | 3-[5-[bis(6-methylheptyl)phosphanyl]pentyl]penta-1,4-diene-1,5-dione |
| SMILES | CC(C)CCCCCP(CCCCCC(C)C)CCCCCC(C=C=O)C=C=O |
| InChI | InChI=1S/C26H47O2P/c1-24(2)14-8-5-11-21-29(22-12-6-9-15-25(3)4)23-13-7-10-16-26(17-19-27)18-20-28/h17-18,24-26H,5-16,21-23H2,1-4H3 |
| InChIKey | MNJHNPRSAFLDEX-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.63 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|