About 6-methylheptyl-λ2-stannane
6-methylheptyl-λ2-stannane (PubChem CID 175215525) has the molecular formula C8H18Sn
and a molecular weight of 232.94 g/mol. Its IUPAC name is 6-methylheptyl-λ2-stannane.
Molecular Properties
| Compound Name | 6-methylheptyl-λ2-stannane |
| PubChem CID | 175215525 |
| Molecular Formula | C8H18Sn |
| Molecular Weight | 232.94 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 6-methylheptyl-λ2-stannane |
| SMILES | CC(C)CCCCC[SnH] |
| InChI | InChI=1S/C8H17.Sn.H/c1-4-5-6-7-8(2)3;;/h8H,1,4-7H2,2-3H3;; |
| InChIKey | APQUNJIRRSSDCV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.94 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-methylheptyl-λ2-stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylheptyl-λ2-stannane?
The IUPAC name of 6-methylheptyl-λ2-stannane (CID 175215525) is 6-methylheptyl-λ2-stannane.
What is the SMILES notation for 6-methylheptyl-λ2-stannane?
The canonical SMILES for 6-methylheptyl-λ2-stannane is CC(C)CCCCC[SnH].
What is the InChIKey of 6-methylheptyl-λ2-stannane?
The InChIKey is APQUNJIRRSSDCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17.Sn.H/c1-4-5-6-7-8(2)3;;/h8H,1,4-7H2,2-3H3;;.
What are the key properties of 6-methylheptyl-λ2-stannane?
6-methylheptyl-λ2-stannane has a molecular weight of 232.94 g/mol, XLogP of 2.52, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylheptyl-λ2-stannane is sourced from PubChem (CID 175215525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).