C21H26N2S — CID 160640659
(2R)-6-(4-methyl-1,3-thiazol-5-yl)-N-(naphthalen-2-ylmethyl)hexan-2-amine (PubChem CID 160640659) has the molecular formula C21H26N2S and a molecular weight of 338.52 g/mol. Its IUPAC name is (2R)-6-(4-methyl-1,3-thiazol-5-yl)-N-(naphthalen-2-ylmethyl)hexan-2-amine.
| Compound Name | (2R)-6-(4-methyl-1,3-thiazol-5-yl)-N-(naphthalen-2-ylmethyl)hexan-2-amine |
|---|---|
| PubChem CID | 160640659 |
| Molecular Formula | C21H26N2S |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (2R)-6-(4-methyl-1,3-thiazol-5-yl)-N-(naphthalen-2-ylmethyl)hexan-2-amine |
| SMILES | Cc1ncsc1CCCC[C@@H](C)NCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H26N2S/c1-16(7-3-6-10-21-17(2)23-15-24-21)22-14-18-11-12-19-8-4-5-9-20(19)13-18/h4-5,8-9,11-13,15-16,22H,3,6-7,10,14H2,1-2H3/t16-/m1/s1 |
| InChIKey | RJDAAEDBOQPGTM-MRXNPFEDSA-N |
| XLogP | 5.50 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|