C24H31N3 — CID 158414323
(2R)-6-[4-(2-aminoethyl)phenyl]-N-(isoquinolin-6-ylmethyl)hexan-2-amine (PubChem CID 158414323) has the molecular formula C24H31N3 and a molecular weight of 361.53 g/mol. Its IUPAC name is (2R)-6-[4-(2-aminoethyl)phenyl]-N-(isoquinolin-6-ylmethyl)hexan-2-amine.
| Compound Name | (2R)-6-[4-(2-aminoethyl)phenyl]-N-(isoquinolin-6-ylmethyl)hexan-2-amine |
|---|---|
| PubChem CID | 158414323 |
| Molecular Formula | C24H31N3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | (2R)-6-[4-(2-aminoethyl)phenyl]-N-(isoquinolin-6-ylmethyl)hexan-2-amine |
| SMILES | C[C@H](CCCCc1ccc(CCN)cc1)NCc1ccc2cnccc2c1 |
| InChI | InChI=1S/C24H31N3/c1-19(4-2-3-5-20-6-8-21(9-7-20)12-14-25)27-17-22-10-11-24-18-26-15-13-23(24)16-22/h6-11,13,15-16,18-19,27H,2-5,12,14,17,25H2,1H3/t19-/m1/s1 |
| InChIKey | GZRUJPDKHYDINL-LJQANCHMSA-N |
| XLogP | 4.63 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|