C22H26ClFN2 — CID 159382135
(2R)-6-(3-fluorophenyl)-N-(isoquinolin-6-ylmethyl)hexan-2-amine;hydrochloride (PubChem CID 159382135) has the molecular formula C22H26ClFN2 and a molecular weight of 372.92 g/mol. Its IUPAC name is (2R)-6-(3-fluorophenyl)-N-(isoquinolin-6-ylmethyl)hexan-2-amine;hydrochloride.
| Compound Name | (2R)-6-(3-fluorophenyl)-N-(isoquinolin-6-ylmethyl)hexan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 159382135 |
| Molecular Formula | C22H26ClFN2 |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (2R)-6-(3-fluorophenyl)-N-(isoquinolin-6-ylmethyl)hexan-2-amine;hydrochloride |
| SMILES | C[C@H](CCCCc1cccc(F)c1)NCc1ccc2cnccc2c1.Cl |
| InChI | InChI=1S/C22H25FN2.ClH/c1-17(5-2-3-6-18-7-4-8-22(23)14-18)25-15-19-9-10-21-16-24-12-11-20(21)13-19;/h4,7-14,16-17,25H,2-3,5-6,15H2,1H3;1H/t17-;/m1./s1 |
| InChIKey | BPNIQWAXSJHHMY-UNTBIKODSA-N |
| XLogP | 5.69 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|