C23H29ClN2O — CID 158232462
(1R,6R)-6-(isoquinolin-6-ylmethylamino)-1-phenylheptan-1-ol;hydrochloride (PubChem CID 158232462) has the molecular formula C23H29ClN2O and a molecular weight of 384.95 g/mol. Its IUPAC name is (1R,6R)-6-(isoquinolin-6-ylmethylamino)-1-phenylheptan-1-ol;hydrochloride.
| Compound Name | (1R,6R)-6-(isoquinolin-6-ylmethylamino)-1-phenylheptan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 158232462 |
| Molecular Formula | C23H29ClN2O |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (1R,6R)-6-(isoquinolin-6-ylmethylamino)-1-phenylheptan-1-ol;hydrochloride |
| SMILES | C[C@H](CCCC[C@@H](O)c1ccccc1)NCc1ccc2cnccc2c1.Cl |
| InChI | InChI=1S/C23H28N2O.ClH/c1-18(7-5-6-10-23(26)20-8-3-2-4-9-20)25-16-19-11-12-22-17-24-14-13-21(22)15-19;/h2-4,8-9,11-15,17-18,23,25-26H,5-7,10,16H2,1H3;1H/t18-,23-;/m1./s1 |
| InChIKey | FLOJAWFDRNJJAA-DOTFVSGYSA-N |
| XLogP | 5.43 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|