C22H25FN2O — CID 157353880
(1S,5R)-1-(4-fluorophenyl)-5-(isoquinolin-6-ylmethylamino)hexan-1-ol (PubChem CID 157353880) has the molecular formula C22H25FN2O and a molecular weight of 352.45 g/mol. Its IUPAC name is (1S,5R)-1-(4-fluorophenyl)-5-(isoquinolin-6-ylmethylamino)hexan-1-ol.
| Compound Name | (1S,5R)-1-(4-fluorophenyl)-5-(isoquinolin-6-ylmethylamino)hexan-1-ol |
|---|---|
| PubChem CID | 157353880 |
| Molecular Formula | C22H25FN2O |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (1S,5R)-1-(4-fluorophenyl)-5-(isoquinolin-6-ylmethylamino)hexan-1-ol |
| SMILES | C[C@H](CCC[C@H](O)c1ccc(F)cc1)NCc1ccc2cnccc2c1 |
| InChI | InChI=1S/C22H25FN2O/c1-16(3-2-4-22(26)18-7-9-21(23)10-8-18)25-14-17-5-6-20-15-24-12-11-19(20)13-17/h5-13,15-16,22,25-26H,2-4,14H2,1H3/t16-,22+/m1/s1 |
| InChIKey | BHVSPOHFSYBFMO-ZHRRBRCNSA-N |
| XLogP | 4.76 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |