C24H28N4O — CID 161001585
(6R)-2-(1H-indazol-5-yl)-6-(isoquinolin-6-ylmethylamino)heptan-2-ol (PubChem CID 161001585) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is (6R)-2-(1H-indazol-5-yl)-6-(isoquinolin-6-ylmethylamino)heptan-2-ol.
| Compound Name | (6R)-2-(1H-indazol-5-yl)-6-(isoquinolin-6-ylmethylamino)heptan-2-ol |
|---|---|
| PubChem CID | 161001585 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | (6R)-2-(1H-indazol-5-yl)-6-(isoquinolin-6-ylmethylamino)heptan-2-ol |
| SMILES | C[C@H](CCCC(C)(O)c1ccc2[nH]ncc2c1)NCc1ccc2cnccc2c1 |
| InChI | InChI=1S/C24H28N4O/c1-17(26-14-18-5-6-20-15-25-11-9-19(20)12-18)4-3-10-24(2,29)22-7-8-23-21(13-22)16-27-28-23/h5-9,11-13,15-17,26,29H,3-4,10,14H2,1-2H3,(H,27,28)/t17-,24?/m1/s1 |
| InChIKey | TVYIDTPPVGRBBG-BPNWFJGMSA-N |
| XLogP | 4.67 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |