C19H23N3S — CID 157247655
(2R)-N-(isoquinolin-6-ylmethyl)-6-(1,2-thiazol-3-yl)hexan-2-amine (PubChem CID 157247655) has the molecular formula C19H23N3S and a molecular weight of 325.48 g/mol. Its IUPAC name is (2R)-N-(isoquinolin-6-ylmethyl)-6-(1,2-thiazol-3-yl)hexan-2-amine.
| Compound Name | (2R)-N-(isoquinolin-6-ylmethyl)-6-(1,2-thiazol-3-yl)hexan-2-amine |
|---|---|
| PubChem CID | 157247655 |
| Molecular Formula | C19H23N3S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | (2R)-N-(isoquinolin-6-ylmethyl)-6-(1,2-thiazol-3-yl)hexan-2-amine |
| SMILES | C[C@H](CCCCc1ccsn1)NCc1ccc2cnccc2c1 |
| InChI | InChI=1S/C19H23N3S/c1-15(4-2-3-5-19-9-11-23-22-19)21-13-16-6-7-18-14-20-10-8-17(18)12-16/h6-12,14-15,21H,2-5,13H2,1H3/t15-/m1/s1 |
| InChIKey | AVYXCDZRDUEGQM-OAHLLOKOSA-N |
| XLogP | 4.58 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|