C23H26N2O2 — CID 158703446
(2S,5R)-2-benzyl-5-(isoquinolin-6-ylmethylamino)hexanoic acid (PubChem CID 158703446) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is (2S,5R)-2-benzyl-5-(isoquinolin-6-ylmethylamino)hexanoic acid.
| Compound Name | (2S,5R)-2-benzyl-5-(isoquinolin-6-ylmethylamino)hexanoic acid |
|---|---|
| PubChem CID | 158703446 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (2S,5R)-2-benzyl-5-(isoquinolin-6-ylmethylamino)hexanoic acid |
| SMILES | C[C@H](CC[C@@H](Cc1ccccc1)C(=O)O)NCc1ccc2cnccc2c1 |
| InChI | InChI=1S/C23H26N2O2/c1-17(7-9-21(23(26)27)13-18-5-3-2-4-6-18)25-15-19-8-10-22-16-24-12-11-20(22)14-19/h2-6,8,10-12,14,16-17,21,25H,7,9,13,15H2,1H3,(H,26,27)/t17-,21+/m1/s1 |
| InChIKey | VJTJCFLDSRSEAV-UTKZUKDTSA-N |
| XLogP | 4.44 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |