C23H29N3O — CID 157134711
(6R)-4-amino-6-(isoquinolin-6-ylmethylamino)-2-phenylheptan-2-ol (PubChem CID 157134711) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is (6R)-4-amino-6-(isoquinolin-6-ylmethylamino)-2-phenylheptan-2-ol.
| Compound Name | (6R)-4-amino-6-(isoquinolin-6-ylmethylamino)-2-phenylheptan-2-ol |
|---|---|
| PubChem CID | 157134711 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | (6R)-4-amino-6-(isoquinolin-6-ylmethylamino)-2-phenylheptan-2-ol |
| SMILES | C[C@H](CC(N)CC(C)(O)c1ccccc1)NCc1ccc2cnccc2c1 |
| InChI | InChI=1S/C23H29N3O/c1-17(12-22(24)14-23(2,27)21-6-4-3-5-7-21)26-15-18-8-9-20-16-25-11-10-19(20)13-18/h3-11,13,16-17,22,26-27H,12,14-15,24H2,1-2H3/t17-,22?,23?/m1/s1 |
| InChIKey | AJMJGROGSFOYDE-UIFUMHDPSA-N |
| XLogP | 3.73 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |