C24H28N4 — CID 158689557
(2R)-6-(1H-indol-3-yl)-2-N-(isoquinolin-6-ylmethyl)hexane-2,4-diamine (PubChem CID 158689557) has the molecular formula C24H28N4 and a molecular weight of 372.52 g/mol. Its IUPAC name is (2R)-6-(1H-indol-3-yl)-2-N-(isoquinolin-6-ylmethyl)hexane-2,4-diamine.
| Compound Name | (2R)-6-(1H-indol-3-yl)-2-N-(isoquinolin-6-ylmethyl)hexane-2,4-diamine |
|---|---|
| PubChem CID | 158689557 |
| Molecular Formula | C24H28N4 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (2R)-6-(1H-indol-3-yl)-2-N-(isoquinolin-6-ylmethyl)hexane-2,4-diamine |
| SMILES | C[C@H](CC(N)CCc1c[nH]c2ccccc12)NCc1ccc2cnccc2c1 |
| InChI | InChI=1S/C24H28N4/c1-17(27-14-18-6-7-20-15-26-11-10-19(20)13-18)12-22(25)9-8-21-16-28-24-5-3-2-4-23(21)24/h2-7,10-11,13,15-17,22,27-28H,8-9,12,14,25H2,1H3/t17-,22?/m1/s1 |
| InChIKey | IGECCTQTYZGSCB-PLEWWHCXSA-N |
| XLogP | 4.54 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |