C24H28N2O2 — CID 158703448
methyl (2S,5R)-2-benzyl-5-(isoquinolin-6-ylmethylamino)hexanoate (PubChem CID 158703448) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is methyl (2S,5R)-2-benzyl-5-(isoquinolin-6-ylmethylamino)hexanoate.
| Compound Name | methyl (2S,5R)-2-benzyl-5-(isoquinolin-6-ylmethylamino)hexanoate |
|---|---|
| PubChem CID | 158703448 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | methyl (2S,5R)-2-benzyl-5-(isoquinolin-6-ylmethylamino)hexanoate |
| SMILES | COC(=O)[C@@H](CC[C@@H](C)NCc1ccc2cnccc2c1)Cc1ccccc1 |
| InChI | InChI=1S/C24H28N2O2/c1-18(26-16-20-9-11-23-17-25-13-12-21(23)15-20)8-10-22(24(27)28-2)14-19-6-4-3-5-7-19/h3-7,9,11-13,15,17-18,22,26H,8,10,14,16H2,1-2H3/t18-,22+/m1/s1 |
| InChIKey | LJDMCNAPQDYBPM-GCJKJVERSA-N |
| XLogP | 4.53 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |