C24H30N2O2 — CID 159572075
(5R)-2-benzyl-5-(isoquinolin-6-ylmethylamino)hexanoic acid;methane (PubChem CID 159572075) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is (5R)-2-benzyl-5-(isoquinolin-6-ylmethylamino)hexanoic acid;methane.
| Compound Name | (5R)-2-benzyl-5-(isoquinolin-6-ylmethylamino)hexanoic acid;methane |
|---|---|
| PubChem CID | 159572075 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | (5R)-2-benzyl-5-(isoquinolin-6-ylmethylamino)hexanoic acid;methane |
| SMILES | C.C[C@H](CCC(Cc1ccccc1)C(=O)O)NCc1ccc2cnccc2c1 |
| InChI | InChI=1S/C23H26N2O2.CH4/c1-17(7-9-21(23(26)27)13-18-5-3-2-4-6-18)25-15-19-8-10-22-16-24-12-11-20(22)14-19;/h2-6,8,10-12,14,16-17,21,25H,7,9,13,15H2,1H3,(H,26,27);1H4/t17-,21?;/m1./s1 |
| InChIKey | MHYFTGKVKXRFFT-MLBZQGEYSA-N |
| XLogP | 5.07 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |