C23H25F3N2 — CID 159822400
(2R)-6-phenyl-N-[[5-(trifluoromethyl)isoquinolin-6-yl]methyl]hexan-2-amine (PubChem CID 159822400) has the molecular formula C23H25F3N2 and a molecular weight of 386.46 g/mol. Its IUPAC name is (2R)-6-phenyl-N-[[5-(trifluoromethyl)isoquinolin-6-yl]methyl]hexan-2-amine.
| Compound Name | (2R)-6-phenyl-N-[[5-(trifluoromethyl)isoquinolin-6-yl]methyl]hexan-2-amine |
|---|---|
| PubChem CID | 159822400 |
| Molecular Formula | C23H25F3N2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | (2R)-6-phenyl-N-[[5-(trifluoromethyl)isoquinolin-6-yl]methyl]hexan-2-amine |
| SMILES | C[C@H](CCCCc1ccccc1)NCc1ccc2cnccc2c1C(F)(F)F |
| InChI | InChI=1S/C23H25F3N2/c1-17(7-5-6-10-18-8-3-2-4-9-18)28-16-20-12-11-19-15-27-14-13-21(19)22(20)23(24,25)26/h2-4,8-9,11-15,17,28H,5-7,10,16H2,1H3/t17-/m1/s1 |
| InChIKey | NMKGXURIGGWFJC-QGZVFWFLSA-N |
| XLogP | 6.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|