C67H79Cl4F2N5O7 — CID 160641298
CID 160641298 (PubChem CID 160641298) has the molecular formula C67H79Cl4F2N5O7 and a molecular weight of 1246.20 g/mol.
| Compound Name | CID 160641298 |
|---|---|
| PubChem CID | 160641298 |
| Molecular Formula | C67H79Cl4F2N5O7 |
| Molecular Weight | 1246.20 g/mol |
| Exact Mass | 1243.47 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC2(CC1)C[C@@H](C(=O)O)[C@H](c1ccnc(Cl)c1F)C21C(=O)Nc2cc(Cl)ccc21.CCCC(=O)C1CC(CC(=O)[C@@H]2CC3(CCC(C)(C)CC3)[C@@]3(C(=O)Nc4cc(Cl)ccc43)[C@H]2c2ccnc(Cl)c2F)C1.CCCC(=O)C1CC(N)C1 |
| InChI | InChI=1S/C34H39Cl2FN2O3.C25H25Cl2FN2O3.C8H15NO/c1-4-5-26(40)20-14-19(15-20)16-27(41)23-18-33(11-9-32(2,3)10-12-33)34(28(23)22-8-13-38-30(36)29(22)37)24-7-6-21(35)17-25(24)39-31(34)42;1-23(2)6-8-24(9-7-23)12-15(21(31)32)18(14-5-10-29-20(27)19(14)28)25(24)16-4-3-13(26)11-17(16)30-22(25)33;1-2-3-8(10)6-4-7(9)5-6/h6-8,13,17,19-20,23,28H,4-5,9-12,14-16,18H2,1-3H3,(H,39,42);3-5,10-11,15,18H,6-9,12H2,1-2H3,(H,30,33)(H,31,32);6-7H,2-5,9H2,1H3/t19?,20?,23-,28-,34+;15-,18+,25?;/m01./s1 |
| InChIKey | RJFBWUBBSPQRAK-YQJQHTCPSA-N |
| XLogP | 15.75 |
| TPSA | 198.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1246.20 |
| LogP ≤ 5 | 15.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|