C17H19Cl3N4O — CID 160645456
3-[(1S)-1-aminoethyl]-8-chloro-N-[(1-oxidopyridin-1-ium-2-yl)methyl]quinolin-2-amine;dihydrochloride (PubChem CID 160645456) has the molecular formula C17H19Cl3N4O and a molecular weight of 401.73 g/mol. Its IUPAC name is 3-[(1S)-1-aminoethyl]-8-chloro-N-[(1-oxidopyridin-1-ium-2-yl)methyl]quinolin-2-amine;dihydrochloride.
| Compound Name | 3-[(1S)-1-aminoethyl]-8-chloro-N-[(1-oxidopyridin-1-ium-2-yl)methyl]quinolin-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 160645456 |
| Molecular Formula | C17H19Cl3N4O |
| Molecular Weight | 401.73 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 3-[(1S)-1-aminoethyl]-8-chloro-N-[(1-oxidopyridin-1-ium-2-yl)methyl]quinolin-2-amine;dihydrochloride |
| SMILES | C[C@H](N)c1cc2cccc(Cl)c2nc1NCc1cccc[n+]1[O-].Cl.Cl |
| InChI | InChI=1S/C17H17ClN4O.2ClH/c1-11(19)14-9-12-5-4-7-15(18)16(12)21-17(14)20-10-13-6-2-3-8-22(13)23;;/h2-9,11H,10,19H2,1H3,(H,20,21);2*1H/t11-;;/m0../s1 |
| InChIKey | RJSOTUOGNGXVMJ-IDMXKUIJSA-N |
| XLogP | 4.00 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.73 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|