About 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-naphthalen-2-ylethanone;phenylboranuide
2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-naphthalen-2-ylethanone;phenylboranuide (PubChem CID 160649337) has the molecular formula C24H29BN2O
and a molecular weight of 372.32 g/mol. Its IUPAC name is 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-naphthalen-2-ylethanone;phenylboranuide.
Molecular Properties
| Compound Name | 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-naphthalen-2-ylethanone;phenylboranuide |
| PubChem CID | 160649337 |
| Molecular Formula | C24H29BN2O |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-naphthalen-2-ylethanone;phenylboranuide |
| SMILES | O=C(C[N+]12CCN(CC1)CC2)c1ccc2ccccc2c1.[BH3-]c1ccccc1 |
| InChI | InChI=1S/C18H21N2O.C6H8B/c21-18(14-20-10-7-19(8-11-20)9-12-20)17-6-5-15-3-1-2-4-16(15)13-17;7-6-4-2-1-3-5-6/h1-6,13H,7-12,14H2;1-5H,7H3/q+1;-1 |
| InChIKey | RKFDLJXJBNVAFI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-naphthalen-2-ylethanone;phenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-naphthalen-2-ylethanone;phenylboranuide?
The IUPAC name of 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-naphthalen-2-ylethanone;phenylboranuide (CID 160649337) is 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-naphthalen-2-ylethanone;phenylboranuide.
What is the SMILES notation for 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-naphthalen-2-ylethanone;phenylboranuide?
The canonical SMILES for 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-naphthalen-2-ylethanone;phenylboranuide is O=C(C[N+]12CCN(CC1)CC2)c1ccc2ccccc2c1.[BH3-]c1ccccc1.
What is the InChIKey of 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-naphthalen-2-ylethanone;phenylboranuide?
The InChIKey is RKFDLJXJBNVAFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N2O.C6H8B/c21-18(14-20-10-7-19(8-11-20)9-12-20)17-6-5-15-3-1-2-4-16(15)13-17;7-6-4-2-1-3-5-6/h1-6,13H,7-12,14H2;1-5H,7H3/q+1;-1.
What are the key properties of 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-naphthalen-2-ylethanone;phenylboranuide?
2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-naphthalen-2-ylethanone;phenylboranuide has a molecular weight of 372.32 g/mol, XLogP of 1.85, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-naphthalen-2-ylethanone;phenylboranuide is sourced from PubChem (CID 160649337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).