C20H14N4O4 — CID 160650596
1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]diazenyl]phenyl]pyrrole-2,5-dione (PubChem CID 160650596) has the molecular formula C20H14N4O4 and a molecular weight of 374.36 g/mol. Its IUPAC name is 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]diazenyl]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]diazenyl]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 160650596 |
| Molecular Formula | C20H14N4O4 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]diazenyl]phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1ccc(/N=N/c2ccc(-n3c(O)ccc3O)cc2)cc1 |
| InChI | InChI=1S/C20H14N4O4/c25-17-9-10-18(26)23(17)15-5-1-13(2-6-15)21-22-14-3-7-16(8-4-14)24-19(27)11-12-20(24)28/h1-12,25-26H/b22-21+ |
| InChIKey | QMZKQILPWLBCMU-QURGRASLSA-N |
| XLogP | 3.73 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|