About 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]diazenyl]phenyl]pyrrole-2,5-dione
1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]diazenyl]phenyl]pyrrole-2,5-dione (PubChem CID 160650596) has the molecular formula C20H14N4O4
and a molecular weight of 374.36 g/mol. Its IUPAC name is 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]diazenyl]phenyl]pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]diazenyl]phenyl]pyrrole-2,5-dione |
| PubChem CID | 160650596 |
| Molecular Formula | C20H14N4O4 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]diazenyl]phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1ccc(/N=N/c2ccc(-n3c(O)ccc3O)cc2)cc1 |
| InChI | InChI=1S/C20H14N4O4/c25-17-9-10-18(26)23(17)15-5-1-13(2-6-15)21-22-14-3-7-16(8-4-14)24-19(27)11-12-20(24)28/h1-12,25-26H/b22-21+ |
| InChIKey | QMZKQILPWLBCMU-QURGRASLSA-N |
| XLogP | 3.73 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]diazenyl]phenyl]pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]diazenyl]phenyl]pyrrole-2,5-dione?
The IUPAC name of 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]diazenyl]phenyl]pyrrole-2,5-dione (CID 160650596) is 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]diazenyl]phenyl]pyrrole-2,5-dione.
What is the SMILES notation for 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]diazenyl]phenyl]pyrrole-2,5-dione?
The canonical SMILES for 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]diazenyl]phenyl]pyrrole-2,5-dione is O=C1C=CC(=O)N1c1ccc(/N=N/c2ccc(-n3c(O)ccc3O)cc2)cc1.
What is the InChIKey of 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]diazenyl]phenyl]pyrrole-2,5-dione?
The InChIKey is QMZKQILPWLBCMU-QURGRASLSA-N. The full InChI is InChI=1S/C20H14N4O4/c25-17-9-10-18(26)23(17)15-5-1-13(2-6-15)21-22-14-3-7-16(8-4-14)24-19(27)11-12-20(24)28/h1-12,25-26H/b22-21+.
What are the key properties of 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]diazenyl]phenyl]pyrrole-2,5-dione?
1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]diazenyl]phenyl]pyrrole-2,5-dione has a molecular weight of 374.36 g/mol, XLogP of 3.73, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]diazenyl]phenyl]pyrrole-2,5-dione is sourced from PubChem (CID 160650596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).