C37H46N2O4 — CID 123979387
1-[4-[[4-[3-[(E)-dodec-1-enyl]-2,5-dihydroxypyrrol-1-yl]-3-ethylphenyl]methyl]-2-ethylphenyl]pyrrole-2,5-dione (PubChem CID 123979387) has the molecular formula C37H46N2O4 and a molecular weight of 582.79 g/mol. Its IUPAC name is 1-[4-[[4-[3-[(E)-dodec-1-enyl]-2,5-dihydroxypyrrol-1-yl]-3-ethylphenyl]methyl]-2-ethylphenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[[4-[3-[(E)-dodec-1-enyl]-2,5-dihydroxypyrrol-1-yl]-3-ethylphenyl]methyl]-2-ethylphenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 123979387 |
| Molecular Formula | C37H46N2O4 |
| Molecular Weight | 582.79 g/mol |
| Exact Mass | 582.35 |
| IUPAC Name | 1-[4-[[4-[3-[(E)-dodec-1-enyl]-2,5-dihydroxypyrrol-1-yl]-3-ethylphenyl]methyl]-2-ethylphenyl]pyrrole-2,5-dione |
| SMILES | CCCCCCCCCC/C=C/c1cc(O)n(-c2ccc(Cc3ccc(N4C(=O)C=CC4=O)c(CC)c3)cc2CC)c1O |
| InChI | InChI=1S/C37H46N2O4/c1-4-7-8-9-10-11-12-13-14-15-16-31-26-36(42)39(37(31)43)33-20-18-28(25-30(33)6-3)23-27-17-19-32(29(5-2)24-27)38-34(40)21-22-35(38)41/h15-22,24-26,42-43H,4-14,23H2,1-3H3/b16-15+ |
| InChIKey | CXCSDDBVFVOMOE-FOCLMDBBSA-N |
| XLogP | 8.58 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.79 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|