C26H40N2O4 — CID 123545076
1-[5-[3-[(E)-dodec-1-enyl]-2,5-dihydroxypyrrol-1-yl]-4-methylpentyl]pyrrole-2,5-dione (PubChem CID 123545076) has the molecular formula C26H40N2O4 and a molecular weight of 444.62 g/mol. Its IUPAC name is 1-[5-[3-[(E)-dodec-1-enyl]-2,5-dihydroxypyrrol-1-yl]-4-methylpentyl]pyrrole-2,5-dione.
| Compound Name | 1-[5-[3-[(E)-dodec-1-enyl]-2,5-dihydroxypyrrol-1-yl]-4-methylpentyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 123545076 |
| Molecular Formula | C26H40N2O4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | 1-[5-[3-[(E)-dodec-1-enyl]-2,5-dihydroxypyrrol-1-yl]-4-methylpentyl]pyrrole-2,5-dione |
| SMILES | CCCCCCCCCC/C=C/c1cc(O)n(CC(C)CCCN2C(=O)C=CC2=O)c1O |
| InChI | InChI=1S/C26H40N2O4/c1-3-4-5-6-7-8-9-10-11-12-15-22-19-25(31)28(26(22)32)20-21(2)14-13-18-27-23(29)16-17-24(27)30/h12,15-17,19,21,31-32H,3-11,13-14,18,20H2,1-2H3/b15-12+ |
| InChIKey | UPTMGBBVIFIMRB-NTCAYCPXSA-N |
| XLogP | 5.78 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|