C45H75NO3 — CID 162061077
1-[(14Z,17Z)-5-[(9Z,12Z)-octadeca-9,12-dienyl]-3-oxotricosa-14,17-dienyl]pyrrole-2,5-dione (PubChem CID 162061077) has the molecular formula C45H75NO3 and a molecular weight of 678.10 g/mol. Its IUPAC name is 1-[(14Z,17Z)-5-[(9Z,12Z)-octadeca-9,12-dienyl]-3-oxotricosa-14,17-dienyl]pyrrole-2,5-dione.
| Compound Name | 1-[(14Z,17Z)-5-[(9Z,12Z)-octadeca-9,12-dienyl]-3-oxotricosa-14,17-dienyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 162061077 |
| Molecular Formula | C45H75NO3 |
| Molecular Weight | 678.10 g/mol |
| Exact Mass | 677.57 |
| IUPAC Name | 1-[(14Z,17Z)-5-[(9Z,12Z)-octadeca-9,12-dienyl]-3-oxotricosa-14,17-dienyl]pyrrole-2,5-dione |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)CC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C45H75NO3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-42(41-43(47)39-40-46-44(48)37-38-45(46)49)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,37-38,42H,3-10,15-16,21-36,39-41H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | YCUHHSVNUXCSOO-MAZCIEHSSA-N |
| XLogP | 13.28 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.10 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|