C22H26N4O3 — CID 160650838
formic acid;5-methyl-3-[6-[(4-methylpiperazin-1-yl)methyl]-3-pyridinyl]-2H-isoquinolin-1-one (PubChem CID 160650838) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is formic acid;5-methyl-3-[6-[(4-methylpiperazin-1-yl)methyl]-3-pyridinyl]-2H-isoquinolin-1-one.
| Compound Name | formic acid;5-methyl-3-[6-[(4-methylpiperazin-1-yl)methyl]-3-pyridinyl]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 160650838 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | formic acid;5-methyl-3-[6-[(4-methylpiperazin-1-yl)methyl]-3-pyridinyl]-2H-isoquinolin-1-one |
| SMILES | Cc1cccc2c(=O)[nH]c(-c3ccc(CN4CCN(C)CC4)nc3)cc12.O=CO |
| InChI | InChI=1S/C21H24N4O.CH2O2/c1-15-4-3-5-18-19(15)12-20(23-21(18)26)16-6-7-17(22-13-16)14-25-10-8-24(2)9-11-25;2-1-3/h3-7,12-13H,8-11,14H2,1-2H3,(H,23,26);1H,(H,2,3) |
| InChIKey | RKJXAFCFNCFRHR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|