C20H32ClN3O4 — CID 160657514
(2S)-2-acetamido-4-methylpentanoic acid;2-(4-chlorophenyl)-2-morpholin-4-ylethanamine (PubChem CID 160657514) has the molecular formula C20H32ClN3O4 and a molecular weight of 413.95 g/mol. Its IUPAC name is (2S)-2-acetamido-4-methylpentanoic acid;2-(4-chlorophenyl)-2-morpholin-4-ylethanamine.
| Compound Name | (2S)-2-acetamido-4-methylpentanoic acid;2-(4-chlorophenyl)-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 160657514 |
| Molecular Formula | C20H32ClN3O4 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (2S)-2-acetamido-4-methylpentanoic acid;2-(4-chlorophenyl)-2-morpholin-4-ylethanamine |
| SMILES | CC(=O)N[C@@H](CC(C)C)C(=O)O.NCC(c1ccc(Cl)cc1)N1CCOCC1 |
| InChI | InChI=1S/C12H17ClN2O.C8H15NO3/c13-11-3-1-10(2-4-11)12(9-14)15-5-7-16-8-6-15;1-5(2)4-7(8(11)12)9-6(3)10/h1-4,12H,5-9,14H2;5,7H,4H2,1-3H3,(H,9,10)(H,11,12)/t;7-/m.0/s1 |
| InChIKey | RLFXCLLAQZMSMO-ZLTKDMPESA-N |
| XLogP | 2.29 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |