C16H24F3NO2 — CID 160662010
tert-butyl 4-fluorobenzoate;3,3-difluoropyrrolidine;methane (PubChem CID 160662010) has the molecular formula C16H24F3NO2 and a molecular weight of 319.37 g/mol. Its IUPAC name is tert-butyl 4-fluorobenzoate;3,3-difluoropyrrolidine;methane.
| Compound Name | tert-butyl 4-fluorobenzoate;3,3-difluoropyrrolidine;methane |
|---|---|
| PubChem CID | 160662010 |
| Molecular Formula | C16H24F3NO2 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | tert-butyl 4-fluorobenzoate;3,3-difluoropyrrolidine;methane |
| SMILES | C.CC(C)(C)OC(=O)c1ccc(F)cc1.FC1(F)CCNC1 |
| InChI | InChI=1S/C11H13FO2.C4H7F2N.CH4/c1-11(2,3)14-10(13)8-4-6-9(12)7-5-8;5-4(6)1-2-7-3-4;/h4-7H,1-3H3;7H,1-3H2;1H4 |
| InChIKey | RLUJEFSAZUWYAL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |