C17H20FNO4 — CID 175638749
tert-butyl 4-(3-fluoro-2,7-dioxoazepan-3-yl)benzoate (PubChem CID 175638749) has the molecular formula C17H20FNO4 and a molecular weight of 321.35 g/mol. Its IUPAC name is tert-butyl 4-(3-fluoro-2,7-dioxoazepan-3-yl)benzoate.
| Compound Name | tert-butyl 4-(3-fluoro-2,7-dioxoazepan-3-yl)benzoate |
|---|---|
| PubChem CID | 175638749 |
| Molecular Formula | C17H20FNO4 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | tert-butyl 4-(3-fluoro-2,7-dioxoazepan-3-yl)benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(C2(F)CCCC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C17H20FNO4/c1-16(2,3)23-14(21)11-6-8-12(9-7-11)17(18)10-4-5-13(20)19-15(17)22/h6-9H,4-5,10H2,1-3H3,(H,19,20,22) |
| InChIKey | WRHMYIYDNIUQNU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|