C21H27FN2O4 — CID 170737619
tert-butyl 4-[4-(3-fluoro-2,6-dioxopiperidin-3-yl)phenyl]piperidine-1-carboxylate (PubChem CID 170737619) has the molecular formula C21H27FN2O4 and a molecular weight of 390.46 g/mol. Its IUPAC name is tert-butyl 4-[4-(3-fluoro-2,6-dioxopiperidin-3-yl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(3-fluoro-2,6-dioxopiperidin-3-yl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170737619 |
| Molecular Formula | C21H27FN2O4 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | tert-butyl 4-[4-(3-fluoro-2,6-dioxopiperidin-3-yl)phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(C3(F)CCC(=O)NC3=O)cc2)CC1 |
| InChI | InChI=1S/C21H27FN2O4/c1-20(2,3)28-19(27)24-12-9-15(10-13-24)14-4-6-16(7-5-14)21(22)11-8-17(25)23-18(21)26/h4-7,15H,8-13H2,1-3H3,(H,23,25,26) |
| InChIKey | GBUZVNKSROGPLE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|