C13H23NO2S — CID 160662868
ethane;N-[(2-methylphenyl)methyl]propane-2-sulfonamide (PubChem CID 160662868) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is ethane;N-[(2-methylphenyl)methyl]propane-2-sulfonamide.
| Compound Name | ethane;N-[(2-methylphenyl)methyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 160662868 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | ethane;N-[(2-methylphenyl)methyl]propane-2-sulfonamide |
| SMILES | CC.Cc1ccccc1CNS(=O)(=O)C(C)C |
| InChI | InChI=1S/C11H17NO2S.C2H6/c1-9(2)15(13,14)12-8-11-7-5-4-6-10(11)3;1-2/h4-7,9,12H,8H2,1-3H3;1-2H3 |
| InChIKey | RLXFSJYKRWWMAM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |