C16H11Cl3FN3 — CID 160664212
6-chloro-N-(4-fluorophenyl)pyridin-2-amine;2,6-dichloropyridine (PubChem CID 160664212) has the molecular formula C16H11Cl3FN3 and a molecular weight of 370.64 g/mol. Its IUPAC name is 6-chloro-N-(4-fluorophenyl)pyridin-2-amine;2,6-dichloropyridine.
| Compound Name | 6-chloro-N-(4-fluorophenyl)pyridin-2-amine;2,6-dichloropyridine |
|---|---|
| PubChem CID | 160664212 |
| Molecular Formula | C16H11Cl3FN3 |
| Molecular Weight | 370.64 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 6-chloro-N-(4-fluorophenyl)pyridin-2-amine;2,6-dichloropyridine |
| SMILES | Clc1cccc(Cl)n1.Fc1ccc(Nc2cccc(Cl)n2)cc1 |
| InChI | InChI=1S/C11H8ClFN2.C5H3Cl2N/c12-10-2-1-3-11(15-10)14-9-6-4-8(13)5-7-9;6-4-2-1-3-5(7)8-4/h1-7H,(H,14,15);1-3H |
| InChIKey | RMBNRSKQFVVTEN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.64 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|