C24H23Cl3N4O2 — CID 161024546
6-chloro-N-(4-methoxyphenyl)pyridin-2-amine;2,6-dichloropyridine;4-methoxyaniline (PubChem CID 161024546) has the molecular formula C24H23Cl3N4O2 and a molecular weight of 505.83 g/mol. Its IUPAC name is 6-chloro-N-(4-methoxyphenyl)pyridin-2-amine;2,6-dichloropyridine;4-methoxyaniline.
| Compound Name | 6-chloro-N-(4-methoxyphenyl)pyridin-2-amine;2,6-dichloropyridine;4-methoxyaniline |
|---|---|
| PubChem CID | 161024546 |
| Molecular Formula | C24H23Cl3N4O2 |
| Molecular Weight | 505.83 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | 6-chloro-N-(4-methoxyphenyl)pyridin-2-amine;2,6-dichloropyridine;4-methoxyaniline |
| SMILES | COc1ccc(N)cc1.COc1ccc(Nc2cccc(Cl)n2)cc1.Clc1cccc(Cl)n1 |
| InChI | InChI=1S/C12H11ClN2O.C7H9NO.C5H3Cl2N/c1-16-10-7-5-9(6-8-10)14-12-4-2-3-11(13)15-12;1-9-7-4-2-6(8)3-5-7;6-4-2-1-3-5(7)8-4/h2-8H,1H3,(H,14,15);2-5H,8H2,1H3;1-3H |
| InChIKey | TYURGCDZCJTWIX-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.83 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|