About 2-N,6-N-bis(4-aminophenyl)pyridine-2,6-diamine
2-N,6-N-bis(4-aminophenyl)pyridine-2,6-diamine (PubChem CID 141294407) has the molecular formula C17H17N5
and a molecular weight of 291.36 g/mol. Its IUPAC name is 2-N,6-N-bis(4-aminophenyl)pyridine-2,6-diamine.
Molecular Properties
| Compound Name | 2-N,6-N-bis(4-aminophenyl)pyridine-2,6-diamine |
| PubChem CID | 141294407 |
| Molecular Formula | C17H17N5 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-N,6-N-bis(4-aminophenyl)pyridine-2,6-diamine |
| SMILES | Nc1ccc(Nc2cccc(Nc3ccc(N)cc3)n2)cc1 |
| InChI | InChI=1S/C17H17N5/c18-12-4-8-14(9-5-12)20-16-2-1-3-17(22-16)21-15-10-6-13(19)7-11-15/h1-11H,18-19H2,(H2,20,21,22) |
| InChIKey | FHESGXWCQUCXPM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-N,6-N-bis(4-aminophenyl)pyridine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,6-N-bis(4-aminophenyl)pyridine-2,6-diamine?
The IUPAC name of 2-N,6-N-bis(4-aminophenyl)pyridine-2,6-diamine (CID 141294407) is 2-N,6-N-bis(4-aminophenyl)pyridine-2,6-diamine.
What is the SMILES notation for 2-N,6-N-bis(4-aminophenyl)pyridine-2,6-diamine?
The canonical SMILES for 2-N,6-N-bis(4-aminophenyl)pyridine-2,6-diamine is Nc1ccc(Nc2cccc(Nc3ccc(N)cc3)n2)cc1.
What is the InChIKey of 2-N,6-N-bis(4-aminophenyl)pyridine-2,6-diamine?
The InChIKey is FHESGXWCQUCXPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N5/c18-12-4-8-14(9-5-12)20-16-2-1-3-17(22-16)21-15-10-6-13(19)7-11-15/h1-11H,18-19H2,(H2,20,21,22).
What are the key properties of 2-N,6-N-bis(4-aminophenyl)pyridine-2,6-diamine?
2-N,6-N-bis(4-aminophenyl)pyridine-2,6-diamine has a molecular weight of 291.36 g/mol, XLogP of 3.73, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,6-N-bis(4-aminophenyl)pyridine-2,6-diamine is sourced from PubChem (CID 141294407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).