C17H17N5 — CID 141294407
2-N,6-N-bis(4-aminophenyl)pyridine-2,6-diamine (PubChem CID 141294407) has the molecular formula C17H17N5 and a molecular weight of 291.36 g/mol. Its IUPAC name is 2-N,6-N-bis(4-aminophenyl)pyridine-2,6-diamine.
| Compound Name | 2-N,6-N-bis(4-aminophenyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 141294407 |
| Molecular Formula | C17H17N5 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-N,6-N-bis(4-aminophenyl)pyridine-2,6-diamine |
| SMILES | Nc1ccc(Nc2cccc(Nc3ccc(N)cc3)n2)cc1 |
| InChI | InChI=1S/C17H17N5/c18-12-4-8-14(9-5-12)20-16-2-1-3-17(22-16)21-15-10-6-13(19)7-11-15/h1-11H,18-19H2,(H2,20,21,22) |
| InChIKey | FHESGXWCQUCXPM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|