C16H12N2 — CID 160668641
3,10-dihydro-1H-indeno[2,1-e]isoindol-2-ium-3-id-2-ylmethanimine (PubChem CID 160668641) has the molecular formula C16H12N2 and a molecular weight of 232.29 g/mol. Its IUPAC name is 3,10-dihydro-1H-indeno[2,1-e]isoindol-2-ium-3-id-2-ylmethanimine.
| Compound Name | 3,10-dihydro-1H-indeno[2,1-e]isoindol-2-ium-3-id-2-ylmethanimine |
|---|---|
| PubChem CID | 160668641 |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 3,10-dihydro-1H-indeno[2,1-e]isoindol-2-ium-3-id-2-ylmethanimine |
| SMILES | [H]/N=C/[N+]1=[C-]c2ccc3c(c2C1)Cc1ccccc1-3 |
| InChI | InChI=1S/C16H12N2/c17-10-18-8-12-5-6-14-13-4-2-1-3-11(13)7-15(14)16(12)9-18/h1-6,10,17H,7,9H2/b17-10+ |
| InChIKey | KFTNVHUUQCHWCU-LICLKQGHSA-N |
| XLogP | 2.69 |
| TPSA | 26.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|